C18H23FN2O5S — CID 154855081
(3aR,6aR)-5-[(5-fluoro-1,3-benzodioxol-4-yl)sulfonyl]-3a-(pyrrolidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 154855081) has the molecular formula C18H23FN2O5S and a molecular weight of 398.46 g/mol. Its IUPAC name is (3aR,6aR)-5-[(5-fluoro-1,3-benzodioxol-4-yl)sulfonyl]-3a-(pyrrolidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-5-[(5-fluoro-1,3-benzodioxol-4-yl)sulfonyl]-3a-(pyrrolidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 154855081 |
| Molecular Formula | C18H23FN2O5S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (3aR,6aR)-5-[(5-fluoro-1,3-benzodioxol-4-yl)sulfonyl]-3a-(pyrrolidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1c(F)ccc2c1OCO2)N1C[C@@H]2COC[C@]2(CN2CCCC2)C1 |
| InChI | InChI=1S/C18H23FN2O5S/c19-14-3-4-15-16(26-12-25-15)17(14)27(22,23)21-7-13-8-24-11-18(13,10-21)9-20-5-1-2-6-20/h3-4,13H,1-2,5-12H2/t13-,18+/m1/s1 |
| InChIKey | MUFSGGCBHNMEQL-ACJLOTCBSA-N |
| XLogP | 1.29 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |