C18H22N2O5S — CID 162631423
6-[[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]sulfonyl]-4-methyl-1H-quinolin-2-one (PubChem CID 162631423) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 6-[[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]sulfonyl]-4-methyl-1H-quinolin-2-one.
| Compound Name | 6-[[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]sulfonyl]-4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 162631423 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 6-[[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]sulfonyl]-4-methyl-1H-quinolin-2-one |
| SMILES | COC[C@@]12COC[C@@H]1CN(S(=O)(=O)c1ccc3[nH]c(=O)cc(C)c3c1)C2 |
| InChI | InChI=1S/C18H22N2O5S/c1-12-5-17(21)19-16-4-3-14(6-15(12)16)26(22,23)20-7-13-8-25-11-18(13,9-20)10-24-2/h3-6,13H,7-11H2,1-2H3,(H,19,21)/t13-,18-/m0/s1 |
| InChIKey | WCMMZCCRMDHSKP-UGSOOPFHSA-N |
| XLogP | 1.12 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |