C19H29NO4S — CID 162630093
(3aR,6aS)-3a-(methoxymethyl)-5-(4-pentylphenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 162630093) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is (3aR,6aS)-3a-(methoxymethyl)-5-(4-pentylphenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-3a-(methoxymethyl)-5-(4-pentylphenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 162630093 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3aR,6aS)-3a-(methoxymethyl)-5-(4-pentylphenyl)sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2C[C@H]3COC[C@@]3(COC)C2)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-3-4-5-6-16-7-9-18(10-8-16)25(21,22)20-11-17-12-24-15-19(17,13-20)14-23-2/h7-10,17H,3-6,11-15H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | IJJMURGCAQTCLC-HKUYNNGSSA-N |
| XLogP | 2.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|