C19H29NO4S — CID 137336326
[(3aR,7aR)-2-(4-pentylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137336326) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is [(3aR,7aR)-2-(4-pentylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-(4-pentylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137336326 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [(3aR,7aR)-2-(4-pentylphenyl)sulfonyl-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2C[C@@H]3COCC[C@]3(CO)C2)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-2-3-4-5-16-6-8-18(9-7-16)25(22,23)20-12-17-13-24-11-10-19(17,14-20)15-21/h6-9,17,21H,2-5,10-15H2,1H3/t17-,19-/m1/s1 |
| InChIKey | CHTKIMRLWCLGBP-IEBWSBKVSA-N |
| XLogP | 2.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|