C16H18N2O7S — CID 164696186
methyl (3aS,6aS)-5-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 164696186) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl (3aS,6aS)-5-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-5-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 164696186 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | methyl (3aS,6aS)-5-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12COC[C@@H]1CN(S(=O)(=O)c1ccc3c(c1)NC(=O)CO3)C2 |
| InChI | InChI=1S/C16H18N2O7S/c1-23-15(20)16-8-18(5-10(16)6-24-9-16)26(21,22)11-2-3-13-12(4-11)17-14(19)7-25-13/h2-4,10H,5-9H2,1H3,(H,17,19)/t10-,16-/m0/s1 |
| InChIKey | DTLHDJAHEKDUDX-QFYYESIMSA-N |
| XLogP | -0.17 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |