About 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide
2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide (PubChem CID 154855445) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide |
| PubChem CID | 154855445 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NC2(C3CCNC3)CC2)[nH]1 |
| InChI | InChI=1S/C13H18N4O2/c14-11(18)9-1-2-10(16-9)12(19)17-13(4-5-13)8-3-6-15-7-8/h1-2,8,15-16H,3-7H2,(H2,14,18)(H,17,19) |
| InChIKey | YFQIDBFMXRQKNK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide?
The IUPAC name of 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide (CID 154855445) is 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide.
What is the SMILES notation for 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide?
The canonical SMILES for 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide is NC(=O)c1ccc(C(=O)NC2(C3CCNC3)CC2)[nH]1.
What is the InChIKey of 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide?
The InChIKey is YFQIDBFMXRQKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c14-11(18)9-1-2-10(16-9)12(19)17-13(4-5-13)8-3-6-15-7-8/h1-2,8,15-16H,3-7H2,(H2,14,18)(H,17,19).
What are the key properties of 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide?
2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide has a molecular weight of 262.31 g/mol, XLogP of -0.01, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(1-pyrrolidin-3-ylcyclopropyl)-1H-pyrrole-2,5-dicarboxamide is sourced from PubChem (CID 154855445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).