C14H24N2O6 — CID 67340995
tert-butyl N-[1-[(3R)-pyrrolidin-3-yl]cyclopropyl]carbamate;oxalic acid (PubChem CID 67340995) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is tert-butyl N-[1-[(3R)-pyrrolidin-3-yl]cyclopropyl]carbamate;oxalic acid.
| Compound Name | tert-butyl N-[1-[(3R)-pyrrolidin-3-yl]cyclopropyl]carbamate;oxalic acid |
|---|---|
| PubChem CID | 67340995 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl N-[1-[(3R)-pyrrolidin-3-yl]cyclopropyl]carbamate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)NC1([C@@H]2CCNC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H22N2O2.C2H2O4/c1-11(2,3)16-10(15)14-12(5-6-12)9-4-7-13-8-9;3-1(4)2(5)6/h9,13H,4-8H2,1-3H3,(H,14,15);(H,3,4)(H,5,6)/t9-;/m1./s1 |
| InChIKey | GOUZEQRDMSUUNJ-SBSPUUFOSA-N |
| XLogP | 0.81 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|