C16H18Cl2N2O — CID 154856536
2-chloro-N-[2-(4-methylphenyl)-1-pyridin-2-ylethyl]acetamide;hydrochloride (PubChem CID 154856536) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-methylphenyl)-1-pyridin-2-ylethyl]acetamide;hydrochloride.
| Compound Name | 2-chloro-N-[2-(4-methylphenyl)-1-pyridin-2-ylethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 154856536 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-chloro-N-[2-(4-methylphenyl)-1-pyridin-2-ylethyl]acetamide;hydrochloride |
| SMILES | Cc1ccc(CC(NC(=O)CCl)c2ccccn2)cc1.Cl |
| InChI | InChI=1S/C16H17ClN2O.ClH/c1-12-5-7-13(8-6-12)10-15(19-16(20)11-17)14-4-2-3-9-18-14;/h2-9,15H,10-11H2,1H3,(H,19,20);1H |
| InChIKey | PFSRMAWJFLNNSI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|