C20H21N5O2 — CID 96539654
N'-[(1R)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]-N-(1-methylpyrazol-4-yl)oxamide (PubChem CID 96539654) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N'-[(1R)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]-N-(1-methylpyrazol-4-yl)oxamide.
| Compound Name | N'-[(1R)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]-N-(1-methylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 96539654 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N'-[(1R)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]-N-(1-methylpyrazol-4-yl)oxamide |
| SMILES | Cc1ccc(C[C@@H](NC(=O)C(=O)Nc2cnn(C)c2)c2ccccn2)cc1 |
| InChI | InChI=1S/C20H21N5O2/c1-14-6-8-15(9-7-14)11-18(17-5-3-4-10-21-17)24-20(27)19(26)23-16-12-22-25(2)13-16/h3-10,12-13,18H,11H2,1-2H3,(H,23,26)(H,24,27)/t18-/m1/s1 |
| InChIKey | FZSDNEZSOKJRIO-GOSISDBHSA-N |
| XLogP | 2.16 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|