C23H26N6O3 — CID 97246873
N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-N'-[(1S)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]oxamide (PubChem CID 97246873) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-N'-[(1S)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]oxamide.
| Compound Name | N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-N'-[(1S)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]oxamide |
|---|---|
| PubChem CID | 97246873 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-N'-[(1S)-2-(4-methylphenyl)-1-pyridin-2-ylethyl]oxamide |
| SMILES | COc1ncnc(N(C)C)c1NC(=O)C(=O)N[C@@H](Cc1ccc(C)cc1)c1ccccn1 |
| InChI | InChI=1S/C23H26N6O3/c1-15-8-10-16(11-9-15)13-18(17-7-5-6-12-24-17)27-21(30)22(31)28-19-20(29(2)3)25-14-26-23(19)32-4/h5-12,14,18H,13H2,1-4H3,(H,27,30)(H,28,31)/t18-/m0/s1 |
| InChIKey | ZDZNJBAIKBVFHZ-SFHVURJKSA-N |
| XLogP | 2.29 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|