C13H23N5O3 — CID 97019682
1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-[(2S)-4-methoxybutan-2-yl]urea (PubChem CID 97019682) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-[(2S)-4-methoxybutan-2-yl]urea.
| Compound Name | 1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-[(2S)-4-methoxybutan-2-yl]urea |
|---|---|
| PubChem CID | 97019682 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-[4-(dimethylamino)-6-methoxypyrimidin-5-yl]-3-[(2S)-4-methoxybutan-2-yl]urea |
| SMILES | COCC[C@H](C)NC(=O)Nc1c(OC)ncnc1N(C)C |
| InChI | InChI=1S/C13H23N5O3/c1-9(6-7-20-4)16-13(19)17-10-11(18(2)3)14-8-15-12(10)21-5/h8-9H,6-7H2,1-5H3,(H2,16,17,19)/t9-/m0/s1 |
| InChIKey | LNZZMENCQPUMOI-VIFPVBQESA-N |
| XLogP | 1.10 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |