C18H24N4O2 — CID 99697524
N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-(1-methylpyrazol-4-yl)oxamide (PubChem CID 99697524) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-(1-methylpyrazol-4-yl)oxamide.
| Compound Name | N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-(1-methylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 99697524 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-(1-methylpyrazol-4-yl)oxamide |
| SMILES | Cc1ccccc1[C@H](CC(C)C)NC(=O)C(=O)Nc1cnn(C)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-12(2)9-16(15-8-6-5-7-13(15)3)21-18(24)17(23)20-14-10-19-22(4)11-14/h5-8,10-12,16H,9H2,1-4H3,(H,20,23)(H,21,24)/t16-/m0/s1 |
| InChIKey | CKOHSFAYVPPCGR-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|