C25H31N3O4 — CID 97007504
N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide (PubChem CID 97007504) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide.
| Compound Name | N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide |
|---|---|
| PubChem CID | 97007504 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N'-[(1S)-3-methyl-1-(2-methylphenyl)butyl]-N-[2-(morpholine-4-carbonyl)phenyl]oxamide |
| SMILES | Cc1ccccc1[C@H](CC(C)C)NC(=O)C(=O)Nc1ccccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H31N3O4/c1-17(2)16-22(19-9-5-4-8-18(19)3)27-24(30)23(29)26-21-11-7-6-10-20(21)25(31)28-12-14-32-15-13-28/h4-11,17,22H,12-16H2,1-3H3,(H,26,29)(H,27,30)/t22-/m0/s1 |
| InChIKey | YPQQDMAOAAHGSE-QFIPXVFZSA-N |
| XLogP | 3.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|