C20H16N2O4S — CID 15485664
5-methyl-4-[2-[(7-nitro-1-benzothiophen-4-yl)oxy]ethyl]-2-phenyl-1,3-oxazole (PubChem CID 15485664) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 5-methyl-4-[2-[(7-nitro-1-benzothiophen-4-yl)oxy]ethyl]-2-phenyl-1,3-oxazole.
| Compound Name | 5-methyl-4-[2-[(7-nitro-1-benzothiophen-4-yl)oxy]ethyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 15485664 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 5-methyl-4-[2-[(7-nitro-1-benzothiophen-4-yl)oxy]ethyl]-2-phenyl-1,3-oxazole |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc([N+](=O)[O-])c2sccc12 |
| InChI | InChI=1S/C20H16N2O4S/c1-13-16(21-20(26-13)14-5-3-2-4-6-14)9-11-25-18-8-7-17(22(23)24)19-15(18)10-12-27-19/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | VJCBIQOPSRWMAM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|