C24H21NO5S — CID 42632477
(Z)-2-methoxy-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]prop-2-enoic acid (PubChem CID 42632477) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is (Z)-2-methoxy-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-methoxy-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 42632477 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (Z)-2-methoxy-3-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1-benzothiophen-7-yl]prop-2-enoic acid |
| SMILES | CO/C(=C\c1cccc2c(OCCc3nc(-c4ccccc4)oc3C)csc12)C(=O)O |
| InChI | InChI=1S/C24H21NO5S/c1-15-19(25-23(30-15)16-7-4-3-5-8-16)11-12-29-21-14-31-22-17(9-6-10-18(21)22)13-20(28-2)24(26)27/h3-10,13-14H,11-12H2,1-2H3,(H,26,27)/b20-13- |
| InChIKey | FYBWBRDGMIEUGE-MOSHPQCFSA-N |
| XLogP | 5.56 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|