C26H25N5O2 — CID 154856749
N-[5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-4-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 154856749) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-4-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-4-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 154856749 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[5,6-dimethyl-7-(3-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]-4-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)Nc2ncnc3c2c(C)c(C)n3-c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H25N5O2/c1-5-22(32)27-14-19-9-11-20(12-10-19)26(33)30-24-23-17(3)18(4)31(25(23)29-15-28-24)21-8-6-7-16(2)13-21/h5-13,15H,1,14H2,2-4H3,(H,27,32)(H,28,29,30,33) |
| InChIKey | JPQNBQOBAXMUNF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|