C23H22N2O4 — CID 162489350
N-[4-[(2,5-dioxocyclopentyl)methyl]phenyl]-4-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 162489350) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[4-[(2,5-dioxocyclopentyl)methyl]phenyl]-4-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[4-[(2,5-dioxocyclopentyl)methyl]phenyl]-4-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 162489350 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[4-[(2,5-dioxocyclopentyl)methyl]phenyl]-4-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)Nc2ccc(CC3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-2-22(28)24-14-16-3-7-17(8-4-16)23(29)25-18-9-5-15(6-10-18)13-19-20(26)11-12-21(19)27/h2-10,19H,1,11-14H2,(H,24,28)(H,25,29) |
| InChIKey | VJEUEOGLGYFYGE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|