C17H24N2O3 — CID 111486450
N-(2-hydroxy-2,3-dimethylbutyl)-4-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 111486450) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylbutyl)-4-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylbutyl)-4-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 111486450 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylbutyl)-4-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccc(C(=O)NCC(C)(O)C(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-5-15(20)18-10-13-6-8-14(9-7-13)16(21)19-11-17(4,22)12(2)3/h5-9,12,22H,1,10-11H2,2-4H3,(H,18,20)(H,19,21) |
| InChIKey | XTMMCPRUIBAANW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|