C10H10Cl2FNO — CID 154856898
2-chloro-N-[1-(3-chloro-5-fluorophenyl)ethyl]acetamide (PubChem CID 154856898) has the molecular formula C10H10Cl2FNO and a molecular weight of 250.10 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-chloro-5-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[1-(3-chloro-5-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 154856898 |
| Molecular Formula | C10H10Cl2FNO |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-chloro-N-[1-(3-chloro-5-fluorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CCl)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2FNO/c1-6(14-10(15)5-11)7-2-8(12)4-9(13)3-7/h2-4,6H,5H2,1H3,(H,14,15) |
| InChIKey | NBYHXZHPJRULHZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|