C13H17N5O4 — CID 154858868
N-[2-[3-(carbamoylamino)pyrrolidin-1-yl]-2-oxoethyl]-3-hydroxypyridine-2-carboxamide (PubChem CID 154858868) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[2-[3-(carbamoylamino)pyrrolidin-1-yl]-2-oxoethyl]-3-hydroxypyridine-2-carboxamide.
| Compound Name | N-[2-[3-(carbamoylamino)pyrrolidin-1-yl]-2-oxoethyl]-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 154858868 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-[2-[3-(carbamoylamino)pyrrolidin-1-yl]-2-oxoethyl]-3-hydroxypyridine-2-carboxamide |
| SMILES | NC(=O)NC1CCN(C(=O)CNC(=O)c2ncccc2O)C1 |
| InChI | InChI=1S/C13H17N5O4/c14-13(22)17-8-3-5-18(7-8)10(20)6-16-12(21)11-9(19)2-1-4-15-11/h1-2,4,8,19H,3,5-7H2,(H,16,21)(H3,14,17,22) |
| InChIKey | AOCMERARNSFIDP-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |