C15H10BrNOS2 — CID 15485913
1-(3-bromophenyl)-2-(1,3-dithietan-2-ylidene)-2-pyridin-4-ylethanone (PubChem CID 15485913) has the molecular formula C15H10BrNOS2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(1,3-dithietan-2-ylidene)-2-pyridin-4-ylethanone.
| Compound Name | 1-(3-bromophenyl)-2-(1,3-dithietan-2-ylidene)-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 15485913 |
| Molecular Formula | C15H10BrNOS2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 1-(3-bromophenyl)-2-(1,3-dithietan-2-ylidene)-2-pyridin-4-ylethanone |
| SMILES | O=C(C(=C1SCS1)c1ccncc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H10BrNOS2/c16-12-3-1-2-11(8-12)14(18)13(15-19-9-20-15)10-4-6-17-7-5-10/h1-8H,9H2 |
| InChIKey | FASCDUKNYCSLQO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|