C15H18N4O3S2 — CID 154859389
N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-2-pyridin-4-ylsulfanylacetamide (PubChem CID 154859389) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-2-pyridin-4-ylsulfanylacetamide.
| Compound Name | N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-2-pyridin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 154859389 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-2-pyridin-4-ylsulfanylacetamide |
| SMILES | CNc1ccc(S(=O)(=O)NC)cc1NC(=O)CSc1ccncc1 |
| InChI | InChI=1S/C15H18N4O3S2/c1-16-13-4-3-12(24(21,22)17-2)9-14(13)19-15(20)10-23-11-5-7-18-8-6-11/h3-9,16-17H,10H2,1-2H3,(H,19,20) |
| InChIKey | GCUHQWXEIGNHPZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |