C21H19N5OS — CID 154860046
[2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phenyl]-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone (PubChem CID 154860046) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is [2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phenyl]-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | [2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phenyl]-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 154860046 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phenyl]-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone |
| SMILES | O=C(c1ccccc1SCc1cn2ccccc2n1)N1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C21H19N5OS/c27-21(26-10-8-18-15(12-26)11-22-24-18)17-5-1-2-6-19(17)28-14-16-13-25-9-4-3-7-20(25)23-16/h1-7,9,11,13H,8,10,12,14H2,(H,22,24) |
| InChIKey | XOUFCCYCDPSAMK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |