C18H19N3O2S — CID 78854545
N-(3-hydroxypropyl)-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide (PubChem CID 78854545) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(3-hydroxypropyl)-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 78854545 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-(3-hydroxypropyl)-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(NCCCO)c1ccccc1SCc1cn2ccccc2n1 |
| InChI | InChI=1S/C18H19N3O2S/c22-11-5-9-19-18(23)15-6-1-2-7-16(15)24-13-14-12-21-10-4-3-8-17(21)20-14/h1-4,6-8,10,12,22H,5,9,11,13H2,(H,19,23) |
| InChIKey | GSSQNYZNMJGIET-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|