C24H21ClN4O2S — CID 35696945
2-chloro-N-[2-[[4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoyl]amino]ethyl]benzamide (PubChem CID 35696945) has the molecular formula C24H21ClN4O2S and a molecular weight of 464.98 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 35696945 |
| Molecular Formula | C24H21ClN4O2S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-chloro-N-[2-[[4-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1Cl)c1ccc(SCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H21ClN4O2S/c25-21-6-2-1-5-20(21)24(31)27-13-12-26-23(30)17-8-10-19(11-9-17)32-16-18-15-29-14-4-3-7-22(29)28-18/h1-11,14-15H,12-13,16H2,(H,26,30)(H,27,31) |
| InChIKey | REAGVLBHOVDCOT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|