C26H34N2O3 — CID 154861617
N-(4-hydroxy-4-phenylcyclohexyl)-4-[(3-methoxyphenyl)methyl]piperidine-1-carboxamide (PubChem CID 154861617) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-(4-hydroxy-4-phenylcyclohexyl)-4-[(3-methoxyphenyl)methyl]piperidine-1-carboxamide.
| Compound Name | N-(4-hydroxy-4-phenylcyclohexyl)-4-[(3-methoxyphenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 154861617 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-(4-hydroxy-4-phenylcyclohexyl)-4-[(3-methoxyphenyl)methyl]piperidine-1-carboxamide |
| SMILES | COc1cccc(CC2CCN(C(=O)NC3CCC(O)(c4ccccc4)CC3)CC2)c1 |
| InChI | InChI=1S/C26H34N2O3/c1-31-24-9-5-6-21(19-24)18-20-12-16-28(17-13-20)25(29)27-23-10-14-26(30,15-11-23)22-7-3-2-4-8-22/h2-9,19-20,23,30H,10-18H2,1H3,(H,27,29) |
| InChIKey | IQTHZHLULUTRKB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |