C25H33NO2 — CID 15233109
4-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)cyclohexan-1-ol (PubChem CID 15233109) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)cyclohexan-1-ol.
| Compound Name | 4-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 15233109 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)-1-(4-methoxyphenyl)cyclohexan-1-ol |
| SMILES | COc1ccc(C2(O)CCC(N3CCC(Cc4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H33NO2/c1-28-24-9-7-22(8-10-24)25(27)15-11-23(12-16-25)26-17-13-21(14-18-26)19-20-5-3-2-4-6-20/h2-10,21,23,27H,11-19H2,1H3 |
| InChIKey | AYAPPYTZEFHPLI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |