C17H18N4O4S — CID 154863270
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 3-ethylsulfanylpyrazine-2-carboxylate (PubChem CID 154863270) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 3-ethylsulfanylpyrazine-2-carboxylate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 3-ethylsulfanylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 154863270 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 3-ethylsulfanylpyrazine-2-carboxylate |
| SMILES | CCSc1nccnc1C(=O)OCC(=O)Nc1ccc(C(=O)NC)cc1 |
| InChI | InChI=1S/C17H18N4O4S/c1-3-26-16-14(19-8-9-20-16)17(24)25-10-13(22)21-12-6-4-11(5-7-12)15(23)18-2/h4-9H,3,10H2,1-2H3,(H,18,23)(H,21,22) |
| InChIKey | WEZQRHWTHAVGLR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |