C10H15NO6S — CID 154865107
3-(furan-2-ylsulfonylamino)-4-methoxy-3-methylbutanoic acid (PubChem CID 154865107) has the molecular formula C10H15NO6S and a molecular weight of 277.30 g/mol. Its IUPAC name is 3-(furan-2-ylsulfonylamino)-4-methoxy-3-methylbutanoic acid.
| Compound Name | 3-(furan-2-ylsulfonylamino)-4-methoxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 154865107 |
| Molecular Formula | C10H15NO6S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3-(furan-2-ylsulfonylamino)-4-methoxy-3-methylbutanoic acid |
| SMILES | COCC(C)(CC(=O)O)NS(=O)(=O)c1ccco1 |
| InChI | InChI=1S/C10H15NO6S/c1-10(7-16-2,6-8(12)13)11-18(14,15)9-4-3-5-17-9/h3-5,11H,6-7H2,1-2H3,(H,12,13) |
| InChIKey | RNUHMCYRAJKICM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |