About (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate
(2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate (PubChem CID 154865451) has the molecular formula C17H15BrFNO3
and a molecular weight of 380.21 g/mol. Its IUPAC name is (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate |
| PubChem CID | 154865451 |
| Molecular Formula | C17H15BrFNO3 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate |
| SMILES | O=C(OCc1ccccc1F)[C@@H]1CCO[C@H]1c1cncc(Br)c1 |
| InChI | InChI=1S/C17H15BrFNO3/c18-13-7-12(8-20-9-13)16-14(5-6-22-16)17(21)23-10-11-3-1-2-4-15(11)19/h1-4,7-9,14,16H,5-6,10H2/t14-,16+/m1/s1 |
| InChIKey | IXFOUUWKDDCECC-ZBFHGGJFSA-N |
| XLogP | 3.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate?
The IUPAC name of (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate (CID 154865451) is (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate.
What is the SMILES notation for (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate?
The canonical SMILES for (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate is O=C(OCc1ccccc1F)[C@@H]1CCO[C@H]1c1cncc(Br)c1.
What is the InChIKey of (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate?
The InChIKey is IXFOUUWKDDCECC-ZBFHGGJFSA-N. The full InChI is InChI=1S/C17H15BrFNO3/c18-13-7-12(8-20-9-13)16-14(5-6-22-16)17(21)23-10-11-3-1-2-4-15(11)19/h1-4,7-9,14,16H,5-6,10H2/t14-,16+/m1/s1.
What are the key properties of (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate?
(2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate has a molecular weight of 380.21 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl (2R,3R)-2-(5-bromo-3-pyridinyl)oxolane-3-carboxylate is sourced from PubChem (CID 154865451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).