C10H22N2O2 — CID 15486717
4-hydroxy-N-propan-2-yl-2-(propan-2-ylamino)butanamide (PubChem CID 15486717) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-hydroxy-N-propan-2-yl-2-(propan-2-ylamino)butanamide.
| Compound Name | 4-hydroxy-N-propan-2-yl-2-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 15486717 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4-hydroxy-N-propan-2-yl-2-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NC(=O)C(CCO)NC(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-7(2)11-9(5-6-13)10(14)12-8(3)4/h7-9,11,13H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | RECTVZDASSTPMK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |