C25H30N2O3 — CID 154868761
N-[4-(4-tert-butylphenyl)cyclohexyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide (PubChem CID 154868761) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)cyclohexyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-[4-(4-tert-butylphenyl)cyclohexyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 154868761 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)cyclohexyl]-3-oxo-4H-1,4-benzoxazine-7-carboxamide |
| SMILES | CC(C)(C)c1ccc(C2CCC(NC(=O)c3ccc4c(c3)OCC(=O)N4)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-25(2,3)19-9-4-16(5-10-19)17-6-11-20(12-7-17)26-24(29)18-8-13-21-22(14-18)30-15-23(28)27-21/h4-5,8-10,13-14,17,20H,6-7,11-12,15H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | XRCLMFYXGYNNJE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |