C15H19N3O3 — CID 154870500
1-cyclopropyl-5-oxo-N-[(1S)-1-pyridin-4-ylethoxy]pyrrolidine-3-carboxamide (PubChem CID 154870500) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-cyclopropyl-5-oxo-N-[(1S)-1-pyridin-4-ylethoxy]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopropyl-5-oxo-N-[(1S)-1-pyridin-4-ylethoxy]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154870500 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-cyclopropyl-5-oxo-N-[(1S)-1-pyridin-4-ylethoxy]pyrrolidine-3-carboxamide |
| SMILES | C[C@H](ONC(=O)C1CC(=O)N(C2CC2)C1)c1ccncc1 |
| InChI | InChI=1S/C15H19N3O3/c1-10(11-4-6-16-7-5-11)21-17-15(20)12-8-14(19)18(9-12)13-2-3-13/h4-7,10,12-13H,2-3,8-9H2,1H3,(H,17,20)/t10-,12?/m0/s1 |
| InChIKey | GJXPWFXCWCKGGY-NUHJPDEHSA-N |
| XLogP | 1.20 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|