C17H15BrFNO3 — CID 154874276
methyl 4-bromo-2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]benzoate (PubChem CID 154874276) has the molecular formula C17H15BrFNO3 and a molecular weight of 380.21 g/mol. Its IUPAC name is methyl 4-bromo-2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]benzoate.
| Compound Name | methyl 4-bromo-2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 154874276 |
| Molecular Formula | C17H15BrFNO3 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | methyl 4-bromo-2-[[(E)-1-(2-fluorophenyl)ethylideneamino]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(Br)cc1CO/N=C(\C)c1ccccc1F |
| InChI | InChI=1S/C17H15BrFNO3/c1-11(14-5-3-4-6-16(14)19)20-23-10-12-9-13(18)7-8-15(12)17(21)22-2/h3-9H,10H2,1-2H3/b20-11+ |
| InChIKey | OQOFRNFDBIAESA-RGVLZGJSSA-N |
| XLogP | 4.32 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|