C17H14BrNO3 — CID 4626545
(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate (PubChem CID 4626545) has the molecular formula C17H14BrNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate.
| Compound Name | (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 4626545 |
| Molecular Formula | C17H14BrNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl 4-bromobenzoate |
| SMILES | O=C(OCC1CC(c2ccccc2)=NO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrNO3/c18-14-8-6-13(7-9-14)17(20)21-11-15-10-16(19-22-15)12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | KNYTVNBFYLKVNJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |