C21H29ClN2O2 — CID 154874717
N-[[1-[(2-chloroacetyl)amino]cycloheptyl]methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 154874717) has the molecular formula C21H29ClN2O2 and a molecular weight of 376.93 g/mol. Its IUPAC name is N-[[1-[(2-chloroacetyl)amino]cycloheptyl]methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[[1-[(2-chloroacetyl)amino]cycloheptyl]methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 154874717 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[[1-[(2-chloroacetyl)amino]cycloheptyl]methyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(CCl)NC1(CNC(=O)c2ccc3c(c2)CCCC3)CCCCCC1 |
| InChI | InChI=1S/C21H29ClN2O2/c22-14-19(25)24-21(11-5-1-2-6-12-21)15-23-20(26)18-10-9-16-7-3-4-8-17(16)13-18/h9-10,13H,1-8,11-12,14-15H2,(H,23,26)(H,24,25) |
| InChIKey | GDRBJVZNPCMYOH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|