About N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide
N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide (PubChem CID 154875611) has the molecular formula C23H23N3O3
and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide |
| PubChem CID | 154875611 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1(c2ccccc2)CC(NC(=O)Cc2noc3ccccc23)C1 |
| InChI | InChI=1S/C23H23N3O3/c1-2-21(27)24-15-23(16-8-4-3-5-9-16)13-17(14-23)25-22(28)12-19-18-10-6-7-11-20(18)29-26-19/h2-11,17H,1,12-15H2,(H,24,27)(H,25,28) |
| InChIKey | RVGYGNHQPIDBHP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide?
The IUPAC name of N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide (CID 154875611) is N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide.
What is the SMILES notation for N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide?
The canonical SMILES for N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide is C=CC(=O)NCC1(c2ccccc2)CC(NC(=O)Cc2noc3ccccc23)C1.
What is the InChIKey of N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide?
The InChIKey is RVGYGNHQPIDBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O3/c1-2-21(27)24-15-23(16-8-4-3-5-9-16)13-17(14-23)25-22(28)12-19-18-10-6-7-11-20(18)29-26-19/h2-11,17H,1,12-15H2,(H,24,27)(H,25,28).
What are the key properties of N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide?
N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide has a molecular weight of 389.46 g/mol, XLogP of 2.89, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-1-phenylcyclobutyl]methyl]prop-2-enamide is sourced from PubChem (CID 154875611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).