C25H29ClN2O2 — CID 154875797
N-[3-[[(2-chloroacetyl)amino]methyl]-3-phenylcyclobutyl]-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxamide (PubChem CID 154875797) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is N-[3-[[(2-chloroacetyl)amino]methyl]-3-phenylcyclobutyl]-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxamide.
| Compound Name | N-[3-[[(2-chloroacetyl)amino]methyl]-3-phenylcyclobutyl]-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 154875797 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[3-[[(2-chloroacetyl)amino]methyl]-3-phenylcyclobutyl]-1-methyl-3,4-dihydro-2H-naphthalene-1-carboxamide |
| SMILES | CC1(C(=O)NC2CC(CNC(=O)CCl)(c3ccccc3)C2)CCCc2ccccc21 |
| InChI | InChI=1S/C25H29ClN2O2/c1-24(13-7-9-18-8-5-6-12-21(18)24)23(30)28-20-14-25(15-20,17-27-22(29)16-26)19-10-3-2-4-11-19/h2-6,8,10-12,20H,7,9,13-17H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | MNVYCVVMNMAEGF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|