C23H24ClN3O3S — CID 154876069
N-[5-(5-chloro-3-methyl-2-piperidin-4-yloxyphenyl)-3-pyridinyl]benzenesulfonamide (PubChem CID 154876069) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-[5-(5-chloro-3-methyl-2-piperidin-4-yloxyphenyl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | N-[5-(5-chloro-3-methyl-2-piperidin-4-yloxyphenyl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154876069 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[5-(5-chloro-3-methyl-2-piperidin-4-yloxyphenyl)-3-pyridinyl]benzenesulfonamide |
| SMILES | Cc1cc(Cl)cc(-c2cncc(NS(=O)(=O)c3ccccc3)c2)c1OC1CCNCC1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-16-11-18(24)13-22(23(16)30-20-7-9-25-10-8-20)17-12-19(15-26-14-17)27-31(28,29)21-5-3-2-4-6-21/h2-6,11-15,20,25,27H,7-10H2,1H3 |
| InChIKey | AZCUZDJOZZOYIP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |