C18H22ClN3O2S — CID 67303116
N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide (PubChem CID 67303116) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67303116 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide |
| SMILES | CN(c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-22(15-9-11-20-12-10-15)18-13-14(7-8-17(18)19)21-25(23,24)16-5-3-2-4-6-16/h2-8,13,15,20-21H,9-12H2,1H3 |
| InChIKey | IPPCZTDXRMNQOJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |