C18H21BrClN3O2S — CID 67303689
2-bromo-N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide (PubChem CID 67303689) has the molecular formula C18H21BrClN3O2S and a molecular weight of 458.81 g/mol. Its IUPAC name is 2-bromo-N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67303689 |
| Molecular Formula | C18H21BrClN3O2S |
| Molecular Weight | 458.81 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 2-bromo-N-[4-chloro-3-[methyl(piperidin-4-yl)amino]phenyl]benzenesulfonamide |
| SMILES | CN(c1cc(NS(=O)(=O)c2ccccc2Br)ccc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C18H21BrClN3O2S/c1-23(14-8-10-21-11-9-14)17-12-13(6-7-16(17)20)22-26(24,25)18-5-3-2-4-15(18)19/h2-7,12,14,21-22H,8-11H2,1H3 |
| InChIKey | JTWWFCINYVTOQD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |