C15H19N3O2 — CID 154876940
N-[(5,6-dimethyl-2-pyridinyl)methyl]-1-prop-2-enoylazetidine-3-carboxamide (PubChem CID 154876940) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-[(5,6-dimethyl-2-pyridinyl)methyl]-1-prop-2-enoylazetidine-3-carboxamide.
| Compound Name | N-[(5,6-dimethyl-2-pyridinyl)methyl]-1-prop-2-enoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 154876940 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[(5,6-dimethyl-2-pyridinyl)methyl]-1-prop-2-enoylazetidine-3-carboxamide |
| SMILES | C=CC(=O)N1CC(C(=O)NCc2ccc(C)c(C)n2)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-4-14(19)18-8-12(9-18)15(20)16-7-13-6-5-10(2)11(3)17-13/h4-6,12H,1,7-9H2,2-3H3,(H,16,20) |
| InChIKey | KORQUCXPYHJABO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|