C13H21N3O4S — CID 154877084
1-[3-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)azetidin-1-yl]prop-2-en-1-one (PubChem CID 154877084) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-[3-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154877084 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[3-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C(=O)N2CCCN(S(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C13H21N3O4S/c1-3-12(17)15-9-11(10-15)13(18)14-5-4-6-16(8-7-14)21(2,19)20/h3,11H,1,4-10H2,2H3 |
| InChIKey | DZNTYNXONKCRGZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|