C18H26N4O4S — CID 166411448
1-[3-[4-(1-methylpyrrol-3-yl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166411448) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[3-[4-(1-methylpyrrol-3-yl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-(1-methylpyrrol-3-yl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166411448 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[3-[4-(1-methylpyrrol-3-yl)sulfonylpiperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(C(=O)N2CCN(S(=O)(=O)c3ccn(C)c3)CC2)C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-3-17(23)21-7-4-5-15(13-21)18(24)20-9-11-22(12-10-20)27(25,26)16-6-8-19(2)14-16/h3,6,8,14-15H,1,4-5,7,9-13H2,2H3 |
| InChIKey | NKECWSZITJINDB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|