C16H26ClNO — CID 154877800
2-chloro-3-[(2,6-dimethylheptan-4-ylamino)methyl]phenol (PubChem CID 154877800) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 2-chloro-3-[(2,6-dimethylheptan-4-ylamino)methyl]phenol.
| Compound Name | 2-chloro-3-[(2,6-dimethylheptan-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 154877800 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-chloro-3-[(2,6-dimethylheptan-4-ylamino)methyl]phenol |
| SMILES | CC(C)CC(CC(C)C)NCc1cccc(O)c1Cl |
| InChI | InChI=1S/C16H26ClNO/c1-11(2)8-14(9-12(3)4)18-10-13-6-5-7-15(19)16(13)17/h5-7,11-12,14,18-19H,8-10H2,1-4H3 |
| InChIKey | FZGFGXMHEFJEPA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |