C23H32N4O3 — CID 154877936
2-cyclopentyl-2-ethoxy-1-[3-[4-(4-methoxyphenyl)triazol-1-yl]piperidin-1-yl]ethanone (PubChem CID 154877936) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-cyclopentyl-2-ethoxy-1-[3-[4-(4-methoxyphenyl)triazol-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-2-ethoxy-1-[3-[4-(4-methoxyphenyl)triazol-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154877936 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-cyclopentyl-2-ethoxy-1-[3-[4-(4-methoxyphenyl)triazol-1-yl]piperidin-1-yl]ethanone |
| SMILES | CCOC(C(=O)N1CCCC(n2cc(-c3ccc(OC)cc3)nn2)C1)C1CCCC1 |
| InChI | InChI=1S/C23H32N4O3/c1-3-30-22(18-7-4-5-8-18)23(28)26-14-6-9-19(15-26)27-16-21(24-25-27)17-10-12-20(29-2)13-11-17/h10-13,16,18-19,22H,3-9,14-15H2,1-2H3 |
| InChIKey | OPIRUNOVIZCTMU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |