C15H15NO7S — CID 154878088
4-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phthalic acid (PubChem CID 154878088) has the molecular formula C15H15NO7S and a molecular weight of 353.35 g/mol. Its IUPAC name is 4-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phthalic acid.
| Compound Name | 4-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phthalic acid |
|---|---|
| PubChem CID | 154878088 |
| Molecular Formula | C15H15NO7S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phthalic acid |
| SMILES | Cc1ccc(CN(C)S(=O)(=O)c2ccc(C(=O)O)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C15H15NO7S/c1-9-3-4-10(23-9)8-16(2)24(21,22)11-5-6-12(14(17)18)13(7-11)15(19)20/h3-7H,8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | IGRDKJANMONOBY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |