C16H14FNO3 — CID 154880178
N-[[4-(4-fluorophenoxy)phenyl]methyl]oxirane-2-carboxamide (PubChem CID 154880178) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)phenyl]methyl]oxirane-2-carboxamide.
| Compound Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 154880178 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]oxirane-2-carboxamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)cc1)C1CO1 |
| InChI | InChI=1S/C16H14FNO3/c17-12-3-7-14(8-4-12)21-13-5-1-11(2-6-13)9-18-16(19)15-10-20-15/h1-8,15H,9-10H2,(H,18,19) |
| InChIKey | NEAVCSMEUMIBTP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|