C19H17FN2O4 — CID 123328566
N-[[4-(4-fluorophenoxy)phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123328566) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123328566 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)NCc2ccc(Oc3ccc(F)cc3)cc2)C(=O)C1=O |
| InChI | InChI=1S/C19H17FN2O4/c1-22-11-16(17(23)19(22)25)18(24)21-10-12-2-6-14(7-3-12)26-15-8-4-13(20)5-9-15/h2-9,16H,10-11H2,1H3,(H,21,24) |
| InChIKey | HGOLRFHXFVNEMW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|