C15H17FN2O4 — CID 123350539
N-[3-(4-fluorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123350539) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123350539 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)NCCCOc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C15H17FN2O4/c1-18-9-12(13(19)15(18)21)14(20)17-7-2-8-22-11-5-3-10(16)4-6-11/h3-6,12H,2,7-9H2,1H3,(H,17,20) |
| InChIKey | VBCDLHKSGKQDOK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|